CymitQuimica logo

CAS 101382-57-4

:

3-(1,2-Dihydro-2-oxo-3-quinolinyl)-2-propenoic acid

Description:
3-(1,2-Dihydro-2-oxo-3-quinolinyl)-2-propenoic acid, with the CAS number 101382-57-4, is a chemical compound that features a quinoline moiety, which is a bicyclic structure known for its aromatic properties. This compound is characterized by the presence of a propenoic acid functional group, indicating it has both unsaturation and acidic properties. The quinoline ring contributes to its potential biological activity, as many quinoline derivatives are known for their pharmacological effects. The presence of the 1,2-dihydro-2-oxo group suggests that it may exhibit keto-enol tautomerism, which can influence its reactivity and stability. Additionally, the compound may participate in various chemical reactions typical of unsaturated carboxylic acids, such as Michael additions or polymerization. Its unique structure may also allow for interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's characteristics suggest potential applications in drug development and organic synthesis, although specific biological activities would require further investigation.
Formula:C12H9NO3
InChI:InChI=1S/C12H9NO3/c14-11(15)6-5-9-7-8-3-1-2-4-10(8)13-12(9)16/h1-7H,(H,13,16)(H,14,15)
InChI key:InChIKey=OURWGONIRUVXGY-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC=2C(NC1=O)=CC=CC2
Synonyms:
  • 3-(1,2-Dihydro-2-oxo-3-quinolinyl)-2-propenoic acid
  • 2-Propenoic acid, 3-(1,2-dihydro-2-oxo-3-quinolinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.