CAS 101383-35-1
:Mulberrofuran Q
Description:
Mulberrofuran Q is a naturally occurring compound primarily derived from the Morus alba (white mulberry) plant. It belongs to the class of flavonoids and is recognized for its potential pharmacological properties. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and anticancer effects, making it a subject of interest in medicinal chemistry and natural product research. Mulberrofuran Q has been studied for its ability to modulate various signaling pathways, which may contribute to its therapeutic potential. Additionally, it is characterized by its unique chemical structure, which includes multiple hydroxyl groups that enhance its reactivity and biological activity. The compound is typically isolated through extraction and purification processes from plant materials, and its stability can be influenced by environmental factors such as light and temperature. Overall, Mulberrofuran Q represents a promising area of study for developing natural products with health benefits.
Formula:C34H24O10
InChI:InChI=1S/C34H24O10/c1-32-14-22(20-6-4-19(37)13-27(20)42-32)33-30(31(32)40)29-24(39)8-16(25-9-15-2-3-18(36)12-26(15)41-25)10-28(29)43-34(33,44-33)21-7-5-17(35)11-23(21)38/h2-13,22,30,35-39H,14H2,1H3
InChI key:InChIKey=MSVXRBNAPJJEDX-UHFFFAOYSA-N
SMILES:O=C1C2C3(C(O3)(OC=4C2=C(O)C=C(C4)C=5OC=6C(C5)=CC=C(O)C6)C7=C(O)C=C(O)C=C7)C8C=9C(OC1(C)C8)=CC(O)=CC9
Synonyms:- 6a-(2,4-Dihydroxyphenyl)-2,11-dihydroxy-9-(6-hydroxy-2-benzofuranyl)-13-methyl-5,13-methano-5H,6aH,13H-oxireno[2,3][1]benzopyrano[4,3-d][1]benzoxocin-12(11bH)-one
- Mulberrofuran Q
- MulberrofuranQ
- 5,13-Methano-5H,6aH,13H-oxireno[2,3][1]benzopyrano[4,3-d][1]benzoxocin-12(11bH)-one, 6a-(2,4-dihydroxyphenyl)-2,11-dihydroxy-9-(6-hydroxy-2-benzofuranyl)-13-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Mulberrofuran Q
CAS:Mulberrofuran Q prevents HHT and thromboxane B2 formation, shielding neurons from OGD-related stress.Formula:C34H24O10Purity:98%Color and Shape:SolidMolecular weight:592.55Mulberrofuran Q
CAS:Controlled ProductMulberrofuran Q (MRQ) is a modulating agent that has an inhibitory effect on neuronal cells. MRQ is derived from mulberrofuran and moracenin, which are flavans with a prenyl group. This compound also contains flavonoids and prenyl groups, which are chemical structures found in plants and fungi. MRQ has been evaluated for its ability to treat neurodegenerative diseases, including Parkinson's disease and Alzheimer's disease. These evaluations have shown that the compound inhibits the activity of the cannabinoid receptors and neocyclomorusin.
Formula:C34H24O10Purity:Min. 95%Molecular weight:592.56 g/mol



