CAS 10139-02-3
:p-Nitrophenyl 2-acetamido-2-deoxy-α-D-glucopyranoside
Description:
p-Nitrophenyl 2-acetamido-2-deoxy-α-D-glucopyranoside, commonly referred to as p-Nitrophenyl N-acetylglucosamine, is a synthetic compound often used in biochemical research, particularly in enzyme assays. This compound features a p-nitrophenyl group, which serves as a chromogenic moiety, allowing for colorimetric detection upon enzymatic hydrolysis. It is a derivative of N-acetylglucosamine, a monosaccharide that plays a crucial role in various biological processes, including cell wall synthesis in bacteria and the formation of glycoproteins and glycolipids. The presence of the acetamido group contributes to its solubility and reactivity. In terms of physical properties, it is typically a white to pale yellow crystalline solid, soluble in water and organic solvents. The compound is stable under normal conditions but should be handled with care due to potential toxicity associated with the nitrophenyl group. Its applications extend to studying glycosidases and other enzymes that hydrolyze glycosidic bonds, making it a valuable tool in glycobiology and enzymology.
Formula:C14H18N2O8
InChI:InChI=1S/C14H18N2O8/c1-7(18)15-11-13(20)12(19)10(6-17)24-14(11)23-9-4-2-8(3-5-9)16(21)22/h2-5,10-14,17,19-20H,6H2,1H3,(H,15,18)/t10-,11-,12-,13-,14+/m1/s1
InChI key:InChIKey=OMRLTNCLYHKQCK-KSTCHIGDSA-N
SMILES:O([C@@H]1[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 4-Nitrophenyl 2-(acetylamino)-2-deoxy-α-D-glucopyranoside
- α-D-Glucoside, p-nitrophenyl 2-acetamido-2-deoxy-
- α-D-Glucopyranoside, 4-nitrophenyl 2-(acetylamino)-2-deoxy-
- p-Nitrophenyl 2-acetamido-2-deoxy-α-D-glucopyranoside
- Glucopyranoside, p-nitrophenyl 2-acetamido-2-deoxy-, α-D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Nitrophenyl N-acetyl-α-D-glucosaminide
CAS:Formula:C14H18N2O8Purity:99%Color and Shape:SolidMolecular weight:342.3013N-((2R,3R,4R,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)tetrahydro-2H-pyran-3-yl)acetamide
CAS:N-((2R,3R,4R,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)tetrahydro-2H-pyran-3-yl)acetamidePurity:99%Molecular weight:342.3g/mol4-Nitrophenyl-N-acetyl-α-D-glucosaminide
CAS:4-Nitrophenyl-N-acetyl-α-D-glucosaminide is a chromogenic substrate for N-acetyl-β-D-glucosaminidase yielding a yellow solution upon cleavage.Formula:C14H18N2O8Molecular weight:342.31 g/molRef: 3D-N-4030
1gTo inquire100mgTo inquire250mgTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquire4-Nitrophenyl 2-acetamido-2-deoxy-a-D-glucopyranoside
CAS:4-Nitrophenyl 2-acetamido-2-deoxy-a-D-glucopyranoside is a chromogenic pNP substrate specifically designed for the analysis of N-acetylglucosaminidase activity. Upon enzyme action, the substrate releases 4-nitrophenol, a yellow compound that can be detected by spectrophotometric methods, providing a reliable and sensitive means of quantifying enzyme activity. This versatile substrate is widely used in biochemical studies, disease diagnostics, and the enzyme production industry.Formula:C14H18N2O8Color and Shape:White Off-White PowderMolecular weight:342.3 g/mol



