CAS 10139-61-4
:3,3-Bis(phenylmethyl)-1(3H)-isobenzofuranone
Description:
3,3-Bis(phenylmethyl)-1(3H)-isobenzofuranone, identified by its CAS number 10139-61-4, is an organic compound characterized by its unique structure that includes an isobenzofuranone core with two phenylmethyl substituents. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of phenyl groups, which contribute to its stability and potential reactivity. The isobenzofuranone moiety suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution and potential photochemical processes. Its molecular structure may also impart interesting optical properties, making it a candidate for applications in materials science or organic synthesis. Additionally, the compound's solubility characteristics can vary depending on the solvent, which is an important consideration for its practical applications. Overall, 3,3-Bis(phenylmethyl)-1(3H)-isobenzofuranone is a compound of interest in organic chemistry, particularly for its structural features and potential utility in various chemical contexts.
Formula:C22H18O2
InChI:InChI=1S/C22H18O2/c23-21-19-13-7-8-14-20(19)22(24-21,15-17-9-3-1-4-10-17)16-18-11-5-2-6-12-18/h1-14H,15-16H2
InChI key:InChIKey=FANDOQBFFGRVRW-UHFFFAOYSA-N
SMILES:C(C1(CC2=CC=CC=C2)C=3C(C(=O)O1)=CC=CC3)C4=CC=CC=C4
Synonyms:- 3,3-Bis(phenylmethyl)-1(3H)-isobenzofuranone
- 3,3-Dibenzyl-phthalide
- Phthalide, 3,3-dibenzyl-
- 1(3H)-Isobenzofuranone, 3,3-bis(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
