CAS 101395-32-8
:N-{2-[(4-methoxybenzyl)(pyridin-2-yl)amino]ethyl}-N-methylpentane-1,5-diamine
Description:
N-{2-[(4-methoxybenzyl)(pyridin-2-yl)amino]ethyl}-N-methylpentane-1,5-diamine, with CAS number 101395-32-8, is a chemical compound characterized by its complex structure, which includes a pentane backbone, amine functional groups, and aromatic components. This compound features a methoxybenzyl group and a pyridine ring, contributing to its potential biological activity and interactions. The presence of multiple amine groups suggests that it may participate in hydrogen bonding and could exhibit basic properties. Its molecular structure indicates that it may be soluble in polar solvents, while the aromatic components may enhance lipophilicity. This compound could be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for a comprehensive understanding of its behavior in various environments.
Formula:C21H32N4O
InChI:InChI=1/C21H32N4O/c1-24(15-7-3-5-13-22)16-17-25(21-8-4-6-14-23-21)18-19-9-11-20(26-2)12-10-19/h4,6,8-12,14H,3,5,7,13,15-18,22H2,1-2H3
SMILES:CN(CCCCCN)CCN(Cc1ccc(cc1)OC)c1ccccn1
Synonyms:- N-(5-Aminopentyl)-N'-(4-methoxybenzyl)-N-methyl-N'-2-pyridinyl-1,2-ethanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.