
CAS 101395-82-8
:3-Hexen-2-one, 5,5,6,6,6-pentafluoro-, (E)-
Description:
3-Hexen-2-one, 5,5,6,6,6-pentafluoro-, (E)- is a fluorinated organic compound characterized by its unique structure and properties. It features a hexenone backbone, which includes a double bond and a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of five fluorine atoms significantly alters its physical and chemical properties, enhancing its lipophilicity and stability compared to its non-fluorinated counterparts. This compound is typically a colorless to pale yellow liquid with a distinctive odor, making it of interest in the fragrance and flavor industries. Additionally, the (E)- configuration indicates the specific geometric arrangement of substituents around the double bond, which can influence its biological activity and interactions. Due to its fluorinated nature, it may exhibit unique characteristics such as increased resistance to degradation and altered solubility in various solvents. Overall, 3-Hexen-2-one, 5,5,6,6,6-pentafluoro-, (E)- is a compound of interest in both industrial applications and research settings.
Formula:C6H5F5O
InChI:InChI=1S/C6H5F5O/c1-4(12)2-3-5(7,8)6(9,10)11/h2-3H,1H3/b3-2+
InChI key:InChIKey=JWBZGVDBTYNRSH-NSCUHMNNSA-N
SMILES:C(C(F)(F)F)(/C=C/C(C)=O)(F)F
Synonyms:- 3-Hexen-2-one, 5,5,6,6,6-pentafluoro-, (E)-
- (E)-5,5,6,6,6-Pentafluoro-3-hexen-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.