
CAS 101398-06-5
:4-Fluoro-N-[4-(1-methylethyl)phenyl]benzamide
Description:
4-Fluoro-N-[4-(1-methylethyl)phenyl]benzamide, identified by its CAS number 101398-06-5, is a chemical compound characterized by its structural features, which include a benzamide core substituted with a fluoro group and an isopropylphenyl moiety. This compound typically exhibits properties associated with aromatic amides, such as moderate solubility in organic solvents and potential stability under standard conditions. The presence of the fluorine atom can influence its electronic properties, potentially enhancing lipophilicity and altering reactivity compared to non-fluorinated analogs. The isopropyl group contributes to steric hindrance, which may affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific biological activities, which can be explored in pharmacological studies. Overall, 4-Fluoro-N-[4-(1-methylethyl)phenyl]benzamide represents a unique structure that may have applications in drug development and chemical research.
Formula:C16H16FNO
InChI:InChI=1S/C16H16FNO/c1-11(2)12-5-9-15(10-6-12)18-16(19)13-3-7-14(17)8-4-13/h3-11H,1-2H3,(H,18,19)
InChI key:InChIKey=HUQDLXDEERRJKZ-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C(C)C)C=C1)(=O)C2=CC=C(F)C=C2
Synonyms:- 4-Fluoro-N-[4-(1-methylethyl)phenyl]benzamide
- Benzamide, 4-fluoro-N-[4-(1-methylethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.