
CAS 101398-32-7
:2-[2-(2-Hydroxyphenyl)hydrazinylidene]propanedinitrile
Description:
2-[2-(2-Hydroxyphenyl)hydrazinylidene]propanedinitrile, with the CAS number 101398-32-7, is an organic compound characterized by its complex structure, which includes a hydrazine moiety and a nitrile functional group. This compound typically exhibits properties associated with both hydrazines and nitriles, such as potential reactivity in condensation reactions and the ability to form coordination complexes with metals. The presence of the hydroxyl group on the phenyl ring may impart additional hydrogen bonding capabilities, influencing its solubility and reactivity. It is likely to be a solid at room temperature, with potential applications in organic synthesis, pharmaceuticals, or as a ligand in coordination chemistry. The compound's stability and reactivity can be affected by environmental factors such as pH and temperature. As with many hydrazine derivatives, it may pose health risks, necessitating careful handling and storage. Overall, this compound represents a unique intersection of functional groups that can be explored for various chemical applications.
Formula:C9H6N4O
InChI:InChI=1S/C9H6N4O/c10-5-7(6-11)12-13-8-3-1-2-4-9(8)14/h1-4,13-14H
InChI key:InChIKey=KOGVEOSBVPGABW-UHFFFAOYSA-N
SMILES:N(N=C(C#N)C#N)C1=C(O)C=CC=C1
Synonyms:- 2-[2-(2-Hydroxyphenyl)hydrazinylidene]propanedinitrile
- Propanedinitrile, 2-[2-(2-hydroxyphenyl)hydrazinylidene]-
- Propanedinitrile, [(2-hydroxyphenyl)hydrazono]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
