CymitQuimica logo

CAS 101401-88-1

:

4a,7-Epoxy-3,8b-ethano-1H,5aH-cyclopenta[4,5]furo[3,2-c]pyran-5a-methanol, hexahydro-3,8a-dimethyl-, (3S,4aR,5aR,7R,8aR,8bR)-

Description:
4a,7-Epoxy-3,8b-ethano-1H,5aH-cyclopenta[4,5]furo[3,2-c]pyran-5a-methanol, hexahydro-3,8a-dimethyl-, (3S,4aR,5aR,7R,8aR,8bR)-, identified by CAS number 101401-88-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates both furan and pyran rings. This compound features multiple stereocenters, which contribute to its specific three-dimensional configuration, influencing its chemical reactivity and potential biological activity. The presence of an epoxy group suggests that it may participate in various chemical reactions, such as nucleophilic attacks or rearrangements. Additionally, the methanol functional group indicates potential for hydrogen bonding, which could affect its solubility and interaction with other molecules. The compound's stereochemistry is crucial for its function, particularly in biological systems where chirality can significantly impact pharmacological properties. Overall, this substance may have applications in medicinal chemistry or as a synthetic intermediate, although specific biological activities or uses would require further investigation.
Formula:C15H22O4
InChI:InChI=1S/C15H22O4/c1-11-3-4-13(9-17-11)12(2)5-10-6-14(12,8-16)19-15(13,7-11)18-10/h10,16H,3-9H2,1-2H3
InChI key:InChIKey=RGGZJNLZRGIMHQ-UHFFFAOYSA-N
SMILES:CC12C34C5(OC1(CO)CC(O5)C2)CC(C)(CC3)OC4
Synonyms:
  • 4a,7-Epoxy-3,8b-ethano-1H,5aH-cyclopenta[4,5]furo[3,2-c]pyran-5a-methanol, hexahydro-3,8a-dimethyl-, (3S,4aR,5aR,7R,8aR,8bR)-
  • 4a,7-Epoxy-3,8b-ethano-1H,5aH-cyclopenta[4,5]furo[3,2-c]pyran-5a-methanol, hexahydro-3,8a-dimethyl-, [3S-(3α,4aβ,5aα,7β,8aα,8bα)]-
  • Sporol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.