CAS 10141-52-3
:Benzenamine, 4-(2-methoxyethoxy)-, hydrochloride (1:1)
Description:
Benzenamine, 4-(2-methoxyethoxy)-, hydrochloride (1:1), also known as 4-(2-methoxyethoxy)aniline hydrochloride, is an organic compound characterized by its amine functional group and ether linkage. It features a benzene ring substituted at the para position with a 2-methoxyethoxy group, which contributes to its solubility and reactivity. The hydrochloride form indicates that the compound is a salt, enhancing its stability and solubility in water. This compound is typically used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. Its properties include being a white to off-white crystalline solid, with potential applications in various chemical reactions due to the presence of both the amine and ether functionalities. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, its unique structure and functional groups make it a valuable compound in synthetic organic chemistry.
Formula:C9H13NO2·ClH
InChI:InChI=1S/C9H13NO2.ClH/c1-11-6-7-12-9-4-2-8(10)3-5-9;/h2-5H,6-7,10H2,1H3;1H
InChI key:InChIKey=WXCHSDFKNNQZOO-UHFFFAOYSA-N
SMILES:O(CCOC)C1=CC=C(N)C=C1.Cl
Synonyms:- p-Phenetidine, β-methoxy-, hydrochloride
- Benzenamine, 4-(2-methoxyethoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
