CAS 101411-68-1
:paulomycin A2
Description:
Paulomycin A2 is a natural product belonging to the class of polyketides, which are known for their diverse biological activities. It is derived from the fermentation of certain actinobacteria, particularly those in the genus Streptomyces. This compound exhibits notable antimicrobial properties, making it of interest in the field of medicinal chemistry and drug discovery. Structurally, paulomycin A2 features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its unique reactivity and biological function. The compound has been studied for its potential applications in treating various infections and may also exhibit cytotoxic effects against certain cancer cell lines. Its mechanism of action typically involves interference with cellular processes, although specific pathways may vary. As with many natural products, the extraction and purification of paulomycin A2 can be challenging, necessitating advanced techniques in organic chemistry. Overall, its intriguing properties continue to inspire research aimed at harnessing its therapeutic potential.
Formula:C34H46N2O17S
InChI:InChI=1/C34H46N2O17S/c1-8-14(3)31(43)50-16(5)34(46)15(4)49-22(10-21(34)47-7)52-27-25(39)29(33(45)11-19(38)24(35)23(28(33)40)30(41)42)51-20(12-48-17(6)37)26(27)53-32(44)18(9-2)36-13-54/h9,14-16,20-22,25-27,29,39,45-46H,8,10-12,35H2,1-7H3,(H,41,42)/b18-9-
Synonyms:- 1-Cyclohexene-1-carboxylic acid, 5-[6-O-acetyl-3-O-[2,6-dideoxy-3-O-methyl-4-C-[(S)-1-(3-methyl-1-oxobutoxy)ethyl]-α-L-lyxo-hexopyranosyl]-4-O-[(Z)-2-isothiocyanato-1-oxo-2-buten-1-yl]-β-D-allopyranosyl]-2-amino-5-hydroxy-3,6-dioxo-, (5S)-
- paulomycin A2
- 6-O-acetyl-1-(4-amino-3-carboxy-1-hydroxy-2,5-dioxocyclohex-3-en-1-yl)-1,5-anhydro-3-O-(2,6-dideoxy-3-O-methyl-4-C-{1-[(2-methylbutanoyl)oxy]ethyl}hexopyranosyl)-4-O-[(2Z)-2-isothiocyanatobut-2-enoyl]hexitol
- 1-Cyclohexene-1-carboxylic acid, 5-(6-O-acetyl-3-O-(2,6-dideoxy-3-O-methyl-4-C-((S)-1-(3-methyl-1-oxobutoxy)ethyl)-alpha-L-lyxo-hexopyranosyl)-4-O-((Z)-2-isothiocyanato-1-oxo-2-butenyl)-beta-D-allopyranosyl)-2-amino-5-hydroxy-3,6-dioxo-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Paulomycin A2
CAS:Paulomycin A2 exhibits antibacterial activity against Gram-positive bacteria and specifically inhibits Staphylococcus aureus that is resistant to penicillin, streptomycin, neomycin, and macrolide antibiotics.Formula:C34H46N2O17SColor and Shape:SolidMolecular weight:786.797
