
CAS 101419-84-5
:2-Methyl-3-(methylamino)-2-propenal
Description:
2-Methyl-3-(methylamino)-2-propenal, also known by its CAS number 101419-84-5, is an organic compound characterized by its structure, which features a propenal backbone with a methylamino group and a methyl substituent. This compound is classified as an α,β-unsaturated aldehyde, which typically exhibits reactivity due to the presence of the conjugated double bond and the aldehyde functional group. It is a colorless to pale yellow liquid at room temperature and has a distinctive odor. The presence of the methylamino group suggests potential for hydrogen bonding and reactivity in various chemical reactions, including nucleophilic additions. Its molecular structure allows it to participate in various organic synthesis processes, making it of interest in medicinal chemistry and material science. Additionally, like many aldehydes, it may be sensitive to oxidation and can undergo polymerization under certain conditions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H9NO
InChI:InChI=1S/C5H9NO/c1-5(4-7)3-6-2/h3-4,6H,1-2H3
InChI key:InChIKey=YLWYIKLACUBHLC-UHFFFAOYSA-N
SMILES:C(=CNC)(C=O)C
Synonyms:- 2-Propenal, 2-methyl-3-(methylamino)-
- 2-Methyl-3-(methylamino)propenal
- 2-Methyl-3-(methylamino)-2-propenal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
