
CAS 101420-66-0
:1H-Indazole, 3-methyl-7-nitro-
Description:
1H-Indazole, 3-methyl-7-nitro- is a heterocyclic organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of a methyl group at the 3-position and a nitro group at the 7-position contributes to its unique chemical properties. This compound typically exhibits a yellow to orange color and is soluble in organic solvents. It may participate in various chemical reactions, including electrophilic substitutions due to the electron-withdrawing nature of the nitro group. The compound is of interest in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its molecular structure allows for interactions with biological targets, making it a candidate for further investigation in drug development. Safety data should be consulted for handling and usage, as nitro compounds can be sensitive and may pose health risks. Overall, 1H-Indazole, 3-methyl-7-nitro- represents a significant class of compounds with diverse applications in chemical research.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-5-6-3-2-4-7(11(12)13)8(6)10-9-5/h2-4H,1H3,(H,9,10)
InChI key:InChIKey=XOMXIHHVCVSVDM-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C(C)=NN2)=CC=C1
Synonyms:- 1H-Indazole, 3-methyl-7-nitro-
- 3-Methyl-7-nitro-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.