CAS 101421-71-0
:5-Quinazolinamine
Description:
5-Quinazolinamine, with the CAS number 101421-71-0, is an organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. This compound typically exhibits properties such as being a white to off-white solid, and it is soluble in polar solvents like water and alcohols. 5-Quinazolinamine is known for its potential biological activities, including antitumor and antimicrobial properties, making it of interest in pharmaceutical research. The presence of the amino group in the quinazoline framework allows for various chemical modifications, which can enhance its biological efficacy or alter its pharmacokinetic properties. Additionally, this compound may participate in hydrogen bonding due to the amino group, influencing its interactions in biological systems. Overall, 5-Quinazolinamine serves as a valuable scaffold in medicinal chemistry, with ongoing studies exploring its therapeutic applications and mechanisms of action.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c9-7-2-1-3-8-6(7)4-10-5-11-8/h1-5H,9H2
InChI key:InChIKey=KWHDQPVGKVPPPS-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC1)N=CN=C2
Synonyms:- 5-Quinazolinamine
- Quinazolin-5-Amine
- Quinazoline, 5-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
