CAS 101421-78-7
:5-(Aminocarbonyl)-2-hydroxybenzoic acid
Description:
5-(Aminocarbonyl)-2-hydroxybenzoic acid, also known as a derivative of salicylic acid, is characterized by the presence of both an amino group and a carboxylic acid functional group, which contribute to its acidic and basic properties. This compound features a hydroxyl group (-OH) attached to a benzene ring, enhancing its solubility in polar solvents. The amino group (-NH2) introduces basicity, allowing for potential interactions with acids and other electrophiles. The carboxylic acid group (-COOH) provides acidic characteristics, enabling the compound to participate in various chemical reactions, such as esterification and amidation. Its molecular structure suggests it may exhibit biological activity, potentially serving as an intermediate in pharmaceutical synthesis or as a ligand in coordination chemistry. Additionally, the compound's ability to form hydrogen bonds due to the hydroxyl and amino groups may influence its reactivity and solubility. Overall, 5-(Aminocarbonyl)-2-hydroxybenzoic acid is a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C8H7NO4
InChI:InChI=1S/C8H7NO4/c9-7(11)4-1-2-6(10)5(3-4)8(12)13/h1-3,10H,(H2,9,11)(H,12,13)
InChI key:InChIKey=FWBUQAPVUDJNAV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C(N)=O)=CC=C1O
Synonyms:- 5-(Aminocarbonyl)-2-hydroxybenzoic acid
- Isophthalamic acid, 6-hydroxy-
- Benzoic acid, 5-(aminocarbonyl)-2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
