CAS 101426-85-1
:3-cyclohexyl-5-(diethylamino)-1,6-dimethylpyrimidine-2,4(1H,3H)-dione
Description:
3-Cyclohexyl-5-(diethylamino)-1,6-dimethylpyrimidine-2,4(1H,3H)-dione, with CAS number 101426-85-1, is a synthetic organic compound belonging to the pyrimidine class. This compound features a pyrimidine ring substituted with a cyclohexyl group and a diethylamino group, along with two methyl groups at the 1 and 6 positions. Its structure suggests potential biological activity, particularly in pharmacology, as many pyrimidine derivatives are known for their roles as pharmaceuticals. The presence of the diethylamino group may enhance its lipophilicity, potentially influencing its absorption and distribution in biological systems. The compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the functional groups present. Its solubility characteristics would typically be influenced by the balance of hydrophilic and hydrophobic regions in its molecular structure. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, although detailed studies would be necessary to elucidate its specific properties and biological effects.
Formula:C16H27N3O2
InChI:InChI=1/C16H27N3O2/c1-5-18(6-2)14-12(3)17(4)16(21)19(15(14)20)13-10-8-7-9-11-13/h13H,5-11H2,1-4H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4(1H,3H)-Pyrimidinedione, 3-cyclohexyl-5-(diethylamino)-1,6-dimethyl-
CAS:Formula:C16H27N3O2Molecular weight:293.4045
