CAS 10143-32-5

1-(2-Ethoxypropoxy)-2-propanol

Description:

1-(2-Ethoxypropoxy)-2-propanol, with the CAS number 10143-32-5, is an organic compound characterized by its ether and alcohol functional groups. It typically appears as a colorless liquid with a mild odor. This substance is known for its solubility in water and various organic solvents, making it useful in formulations requiring good wetting and emulsifying properties. Its molecular structure includes a propanol backbone, which contributes to its hydrophilic nature, while the ethoxypropoxy group enhances its compatibility with non-polar solvents. This compound is often utilized in industrial applications, including as a solvent in coatings, paints, and cleaning products. Additionally, it may serve as an intermediate in the synthesis of other chemical compounds. Safety data indicates that, like many organic solvents, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage and handling procedures are essential to minimize exposure and ensure safe usage in various applications.

Formula: C₈H₁₈O₃

InChI: InChI=1S/C8H18O3/c1-4-11-8(3)6-10-5-7(2)9/h7-9H,4-6H2,1-3H3

InChI key: InChIKey=QWOZZTWBWQMEPD-UHFFFAOYSA-N

SMILES: C(COCC(C)O)(OCC)C

Synonyms:

• 2-Propanol, 1-(2-ethoxypropoxy)-
• 1-(2-Ethoxypropoxy)-2-propanol

2-Propanol, 1-(2-ethoxypropoxy)-

CAS: 10143-32-5

Formula: C₈H₁₈O₃

Molecular weight: 162.2267

Ref: IN-DA0004HT