CAS 10143-66-5
:1,3-dimethoxybutane
Description:
1,3-Dimethoxybutane is an organic compound characterized by its structure, which features a butane backbone with two methoxy (-OCH₃) groups attached to the first and third carbon atoms. This compound is a colorless liquid at room temperature and is known for its relatively low viscosity and moderate volatility. It has a pleasant, ether-like odor, making it useful in various applications, including as a solvent in organic synthesis and in the formulation of fragrances. The presence of methoxy groups contributes to its polar nature, enhancing its solubility in polar solvents while still allowing for some degree of solubility in non-polar solvents. 1,3-Dimethoxybutane is stable under normal conditions but should be handled with care due to its flammability. Its chemical properties allow it to participate in various reactions typical of ethers and alcohols, making it a versatile compound in organic chemistry. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C6H14O2
InChI:InChI=1/C6H14O2/c1-6(8-3)4-5-7-2/h6H,4-5H2,1-3H3
InChI key:InChIKey=JCRQEORWPZVZJP-UHFFFAOYSA-N
SMILES:C(CCOC)(OC)C
Synonyms:- Brn 1732425
- Butane,1,3-dimethoxy-
- 1,3-Dimethoxybutane
- 1,3-Dimethoxybutane
- 4-01-00-02509 (Beilstein Handbook Reference)
- Dimethoxybutane, 1,3-
- 1,3-DIMETHOXY-BUTAN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
