CymitQuimica logo

CAS 10143-67-6

:

6-Methyl-2,5,7,10-tetraoxaundecane

Description:
6-Methyl-2,5,7,10-tetraoxaundecane, with the CAS number 10143-67-6, is a chemical compound characterized by its unique structure that includes multiple ether linkages and a methyl group. This compound belongs to the class of polyethers, which are known for their flexibility and low reactivity due to the presence of ether functional groups. The tetraoxaundecane structure indicates that it contains four oxygen atoms integrated into its carbon chain, contributing to its solubility in polar solvents and potential applications in various fields, including materials science and pharmaceuticals. The presence of the methyl group can influence its physical properties, such as boiling point and viscosity. Additionally, compounds like this may exhibit interesting thermal and mechanical properties, making them suitable for use in specialized applications, including as surfactants or in the synthesis of more complex molecules. However, specific data regarding its toxicity, stability, and reactivity would require further investigation or reference to safety data sheets and chemical databases.
Formula:C8H18O4
InChI:InChI=1S/C8H18O4/c1-8(11-6-4-9-2)12-7-5-10-3/h8H,4-7H2,1-3H3
InChI key:InChIKey=QAFHKXJNUMPEMF-UHFFFAOYSA-N
SMILES:O(C(OCCOC)C)CCOC
Synonyms:
  • 6-Methyl-2,5,7,10-tetraoxaundecane
  • 1,1-Bis(2-methoxyethoxy)ethane
  • 2,5,7,10-Tetraoxaundecane, 6-methyl-
  • Acetaldehyde, bis(2-methoxyethyl) acetal
  • 1,1-Di(2-methoxyethoxy)ethane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.