CAS 10145-04-7

2-Amino-1-(3,4-difluorophenyl)ethanol

Description:

2-Amino-1-(3,4-difluorophenyl)ethanol is an organic compound characterized by the presence of an amino group and a hydroxyl group attached to a two-carbon ethyl chain, with a difluorophenyl substituent. Its molecular structure features a phenyl ring that has two fluorine atoms positioned at the 3 and 4 positions, which significantly influences its chemical properties and reactivity. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group. The amino group can participate in hydrogen bonding, enhancing its solubility in water. 2-Amino-1-(3,4-difluorophenyl)ethanol may exhibit biological activity, making it of interest in pharmaceutical research. Its fluorinated phenyl group can contribute to lipophilicity, potentially affecting its interaction with biological targets. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₉F₂NO

InChI: InChI=1S/C8H9F2NO/c9-6-2-1-5(3-7(6)10)8(12)4-11/h1-3,8,12H,4,11H2

SMILES: c1cc(c(cc1C(CN)O)F)F

2-amino-1-(3,4-difluorophenyl)ethan-1-ol

CAS: 10145-04-7

Formula: C₈H₉F₂NO

Purity: 97%

Molecular weight: 173.1600

Ref: IN-DA0004IJ

2-Amino-1-(3,4-difluorophenyl)ethan-1-ol

CAS: 10145-04-7

Versatile small molecule scaffold

Formula: C₈H₉F₂NO

Purity: Min. 95%

Molecular weight: 173.16 g/mol

Ref: 3D-KAA14504