CAS 1014613-46-7

4-Iodo-2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine

Description:

4-Iodo-2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both iodine and trifluoromethyl functional groups. The presence of the iodine atom contributes to its potential reactivity and may influence its biological activity, while the trifluoromethyl group enhances lipophilicity and can affect the compound's electronic properties. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine ring, which is often associated with bioactive compounds. Additionally, the trifluoromethyl group can enhance the compound's pharmacokinetic properties. As with many halogenated compounds, it is important to handle it with care, considering potential toxicity and environmental impact. Overall, 4-Iodo-2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine represents a valuable compound for further research in various chemical and biological applications.

Formula: C₈H₄F₃IN₂

InChI: InChI=1S/C8H4F3IN2/c9-8(10,11)6-3-4-5(12)1-2-13-7(4)14-6/h1-3H,(H,13,14)

InChI key: InChIKey=PVQFPIBCYBPANG-UHFFFAOYSA-N

SMILES: IC1=C2C(NC(C(F)(F)F)=C2)=NC=C1

Synonyms:

• 4-Iodo-2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 4-iodo-2-(trifluoromethyl)-