CymitQuimica logo

CAS 1014614-11-9

:

4-Bromo-2-cyclopropyl-1H-pyrrolo[2,3-b]pyridine

Description:
4-Bromo-2-cyclopropyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and a pyrrole moiety. The presence of a bromine atom at the 4-position and a cyclopropyl group at the 2-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Additionally, the presence of the bromine substituent may enhance its electrophilic character, influencing its reactivity in various chemical reactions. Overall, 4-Bromo-2-cyclopropyl-1H-pyrrolo[2,3-b]pyridine represents a valuable scaffold for further exploration in synthetic and medicinal chemistry.
Formula:C10H9BrN2
InChI:InChI=1S/C10H9BrN2/c11-8-3-4-12-10-7(8)5-9(13-10)6-1-2-6/h3-6H,1-2H2,(H,12,13)
InChI key:InChIKey=RIUXWEGBWYUUEF-UHFFFAOYSA-N
SMILES:BrC1=C2C=C(NC2=NC=C1)C3CC3
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4-bromo-2-cyclopropyl-
  • 4-Bromo-2-cyclopropyl-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.