CymitQuimica logo

CAS 1014625-94-5

:

3,4′-Dihydroxy[1,1′-biphenyl]-4-carboxaldehyde

Description:
3,4′-Dihydroxy[1,1′-biphenyl]-4-carboxaldehyde, identified by its CAS number 1014625-94-5, is an organic compound characterized by the presence of two hydroxyl groups and an aldehyde functional group attached to a biphenyl structure. This compound exhibits properties typical of phenolic compounds, including potential antioxidant activity due to the presence of hydroxyl groups, which can donate hydrogen atoms to free radicals. The aldehyde group contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. The compound's structure suggests it may have applications in organic synthesis, potentially serving as an intermediate in the production of more complex molecules. Additionally, the presence of multiple functional groups may influence its solubility and interaction with biological systems, making it of interest in medicinal chemistry and materials science. Overall, 3,4′-Dihydroxy[1,1′-biphenyl]-4-carboxaldehyde is a versatile compound with potential utility in various chemical and pharmaceutical applications.
Formula:C13H10O3
InChI:InChI=1S/C13H10O3/c14-8-11-2-1-10(7-13(11)16)9-3-5-12(15)6-4-9/h1-8,15-16H
InChI key:InChIKey=ZZEHKCSHIYNPRC-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1C=O)C2=CC=C(O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-carboxaldehyde, 3,4′-dihydroxy-
  • 3,4′-Dihydroxy-[1,1′-biphenyl]-4-carbaldehyde
  • 3,4′-Dihydroxy[1,1′-biphenyl]-4-carboxaldehyde
  • 2-Hydroxy-4-(4-hydroxyphenyl)benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.