CAS 1014631-61-8

Ethyl 1-(3-pyridinyl)-1H-pyrazole-3-carboxylate

Description:

Ethyl 1-(3-pyridinyl)-1H-pyrazole-3-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a pyridine moiety. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the ethyl ester group contributes to its solubility in organic solvents, while the pyridine and pyrazole rings may influence its reactivity and interaction with biological targets. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, its properties can be influenced by factors such as pH and temperature, which may affect its stability and reactivity. Overall, Ethyl 1-(3-pyridinyl)-1H-pyrazole-3-carboxylate represents a versatile scaffold for further chemical modifications and applications in pharmaceutical research.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c1-2-16-11(15)10-5-7-14(13-10)9-4-3-6-12-8-9/h3-8H,2H2,1H3

InChI key: InChIKey=KCZZFDOHVREAMM-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=NN(C=C1)C=2C=CC=NC2

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-(3-pyridinyl)-, ethyl ester
• Ethyl 1-(3-pyridinyl)-1H-pyrazole-3-carboxylate