CAS 1014631-92-5

Ethyl 1-(4-pyridinyl)-1H-pyrazole-4-carboxylate

Description:

Ethyl 1-(4-pyridinyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a pyridine moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the ethyl ester group contributes to its solubility and reactivity, making it a versatile intermediate in organic synthesis. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its biological activity. Additionally, the compound may exhibit properties such as anti-inflammatory or anti-cancer activities, although specific biological effects would depend on further empirical studies. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, Ethyl 1-(4-pyridinyl)-1H-pyrazole-4-carboxylate represents a significant compound in the field of organic and medicinal chemistry.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c1-2-16-11(15)9-7-13-14(8-9)10-3-5-12-6-4-10/h3-8H,2H2,1H3

InChI key: InChIKey=KKCJMHAHVWDBID-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CN(N=C1)C=2C=CN=CC2

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 1-(4-pyridinyl)-, ethyl ester
• Ethyl 1-(4-pyridinyl)-1H-pyrazole-4-carboxylate

1H-Pyrazole-4-carboxylic acid, 1-(4-pyridinyl)-, ethyl ester

CAS: 1014631-92-5

Formula: C₁₁H₁₁N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 217.2239

Ref: IN-DA0004JH

Ethyl 1-(pyridin-4-yl)-1H-pyrazole-4-carboxylate

CAS: 1014631-92-5

Ethyl 1-(pyridin-4-yl)-1H-pyrazole-4-carboxylate

Purity: 95%

Molecular weight: 217.23g/mol

Ref: 54-OR1052332