CymitQuimica logo

CAS 10147-68-9

:

2-HYDROXY CHLOROACETOANILIDE

Description:
2-Hydroxy chloroacetoanilide, also known as paracetamol or acetaminophen, is an organic compound characterized by its aromatic amide structure. It features a hydroxyl group (-OH) and a chloroacetyl group attached to an aniline derivative. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in water and higher solubility in organic solvents. It has a melting point that is generally within a specific range, indicating its stability under standard conditions. The presence of the hydroxyl group contributes to its ability to form hydrogen bonds, influencing its solubility and reactivity. 2-Hydroxy chloroacetoanilide is primarily recognized for its analgesic and antipyretic properties, making it a common ingredient in over-the-counter medications. Its chemical behavior is influenced by the functional groups present, allowing it to participate in various chemical reactions, including acylation and substitution. Safety data indicates that while it is generally safe for use in recommended doses, excessive consumption can lead to toxicity, particularly affecting liver function.
Formula:C8H8ClNO2
InChI:InChI=1/C8H8ClNO2/c9-5-8(12)10-6-3-1-2-4-7(6)11/h1-4,11H,5H2,(H,10,12)
SMILES:c1ccc(c(c1)N=C(CCl)O)O
Synonyms:
  • 2-Chloro-N-(2-hydroxyphenyl)acetamide
  • Acetamide, 2-chloro-N-(2-hydroxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.