CymitQuimica logo

CAS 101491-37-6

:

N-(N'-carbamimidoylcarbamimidoyl)-2-hydroxy-N-(2-hydroxyethyl)ethanaminium chloride

Description:
N-(N'-carbamimidoylcarbamimidoyl)-2-hydroxy-N-(2-hydroxyethyl)ethanaminium chloride, with CAS number 101491-37-6, is a complex organic compound characterized by its unique structural features, including multiple functional groups such as carbamimidoyl and hydroxyethyl moieties. This compound is likely to exhibit properties typical of ammonium salts, including solubility in water due to the presence of ionic and polar functional groups. Its structure suggests potential biological activity, possibly as a ligand or in biochemical applications, given the presence of hydroxyl groups that can participate in hydrogen bonding. The compound may also demonstrate stability under various pH conditions, although specific stability data would depend on environmental factors. Additionally, its synthesis may involve multi-step organic reactions, highlighting its complexity. Overall, this compound's characteristics make it of interest in fields such as medicinal chemistry and biochemistry, where its interactions with biological systems could be explored further.
Formula:C6H16ClN5O2
InChI:InChI=1/C6H15N5O2.ClH/c7-5(8)10-6(9)11(1-3-12)2-4-13;/h12-13H,1-4H2,(H5,7,8,9,10);1H
SMILES:C(CO)N(CCO)C(=N)NC(=N)N.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.