CAS 101491-39-8: N-butyl-N-(N'-carbamimidoylcarbamimidoyl)butan-1-aminium chloride

Description: N-butyl-N-(N'-carbamimidoylcarbamimidoyl)butan-1-aminium chloride, with the CAS number 101491-39-8, is a quaternary ammonium compound characterized by its complex structure, which includes a butyl group and carbamimidoyl moieties. This compound typically exhibits properties associated with quaternary ammonium salts, such as solubility in polar solvents and potential antimicrobial activity. Its structure suggests that it may participate in hydrogen bonding due to the presence of the carbamimidoyl groups, which can influence its reactivity and interactions with biological systems. The chloride ion serves as a counterion, contributing to the overall stability of the compound in solution. Given its unique functional groups, this substance may have applications in pharmaceuticals or as a biochemical reagent, although specific applications would depend on further research into its biological activity and chemical behavior. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₀H₂₄ClN₅

InChI: InChI=1/C10H23N5.ClH/c1-3-5-7-15(8-6-4-2)10(13)14-9(11)12;/h3-8H2,1-2H3,(H5,11,12,13,14);1H

Imidodicarbonimidic diamide, N,N-dibutyl-, hydrochloride (1:1)

CAS: 101491-39-8

• Formula: C₁₀H₂₄ClN₅
• Molecular weight: 249.7841

1,1-Dibutylbiguanide hydrochloride

CAS: 101491-39-8

• Molecular weight: 249.7899932861328