CAS 101491-40-1

N-[N'-(N'-butylcarbamimidoyl)carbamimidoyl]butan-1-aminium chloride

Description:

N-[N'-(N'-butylcarbamimidoyl)carbamimidoyl]butan-1-aminium chloride, with CAS number 101491-40-1, is a chemical compound characterized by its complex structure that includes multiple carbamimidoyl groups and a butan-1-aminium moiety. This compound is typically a white to off-white solid and is soluble in water due to the presence of the ammonium group, which enhances its ionic character. The presence of the butyl group contributes to its hydrophobic characteristics, while the carbamimidoyl groups may impart biological activity, potentially influencing its interaction with biological systems. As a quaternary ammonium salt, it may exhibit properties such as antimicrobial activity or serve as a surfactant. Its specific applications can vary, but it is often explored in fields such as medicinal chemistry and materials science. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₀H₂₄ClN₅

InChI: InChI=1/C10H23N5.ClH/c1-3-5-7-13-9(11)15-10(12)14-8-6-4-2;/h3-8H2,1-2H3,(H5,11,12,13,14,15);1H

SMILES: CCCCNC(=N)NC(=N)NCCCC.Cl

Imidodicarbonimidic diamide, N,N'-dibutyl-, hydrochloride (1:1)

CAS: 101491-40-1

Formula: C₁₀H₂₄ClN₅

Molecular weight: 249.7841

Ref: IN-DA0004LE