CAS 101491-44-5
:N-(N'-carbamimidoylcarbamimidoyl)octan-1-aminium chloride
Description:
N-(N'-carbamimidoylcarbamimidoyl)octan-1-aminium chloride, with the CAS number 101491-44-5, is a chemical compound characterized by its quaternary ammonium structure, which includes a long hydrocarbon chain (octan-1-aminium) and multiple carbamimidoyl functional groups. This compound typically exhibits properties associated with both amines and quaternary ammonium salts, such as solubility in polar solvents and potential biological activity. The presence of the carbamimidoyl groups suggests it may participate in hydrogen bonding and could act as a ligand in coordination chemistry. Additionally, the chloride ion indicates that it is a salt, which may influence its stability and reactivity. The long alkyl chain contributes to its hydrophobic characteristics, potentially affecting its interaction with biological membranes or other organic compounds. Overall, this compound may have applications in fields such as medicinal chemistry, materials science, or as a surfactant, depending on its specific properties and behavior in various environments.
Formula:C10H24ClN5
InChI:InChI=1/C10H23N5.ClH/c1-2-3-4-5-6-7-8-14-10(13)15-9(11)12;/h2-8H2,1H3,(H6,11,12,13,14,15);1H
SMILES:CCCCCCCCNC(=N)NC(=N)N.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Imidodicarbonimidic diamide, N-octyl-, hydrochloride (1:1)
CAS:Formula:C10H24ClN5Molecular weight:249.7841
