CAS 101491-45-6

N-butyl-N-[N'-(N'-butylcarbamimidoyl)carbamimidoyl]butan-1-aminium chloride

Description:

N-butyl-N-[N'-(N'-butylcarbamimidoyl)carbamimidoyl]butan-1-aminium chloride, with the CAS number 101491-45-6, is a quaternary ammonium compound characterized by its complex structure that includes multiple carbamimidoyl groups. This substance typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can enhance solubility in water and facilitate interactions with biological membranes. Its structure suggests potential applications in fields like pharmaceuticals, where it may act as a drug delivery agent or in formulations requiring antimicrobial properties. The presence of butyl groups contributes to its hydrophobic characteristics, while the ammonium and carbamimidoyl functionalities may impart unique reactivity and binding capabilities. Additionally, as a chloride salt, it is likely to be stable under standard conditions but may require careful handling due to its potential biological activity. Overall, this compound's unique combination of functional groups positions it as a versatile candidate for various chemical and biological applications.

Formula: C₁₄H₃₂ClN₅

InChI: InChI=1/C14H31N5.ClH/c1-4-7-10-17-13(15)18-14(16)19(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3,(H4,15,16,17,18);1H

Imidodicarbonimidic diamide, N,N,N'-tributyl-, hydrochloride (1:1)

CAS: 101491-45-6

Formula: C₁₄H₃₂ClN₅

Molecular weight: 305.8904

Ref: IN-DA0004LA