CymitQuimica logo

CAS 101494-94-4

:

8-Chloro-1(2H)-phthalazinone

Description:
8-Chloro-1(2H)-phthalazinone is a chemical compound characterized by its phthalazinone structure, which features a fused bicyclic system containing a nitrogen atom. This compound is typically recognized for its chlorinated derivative, where a chlorine atom is substituted at the 8-position of the phthalazinone ring. It is a crystalline solid that is often used in organic synthesis and medicinal chemistry due to its potential biological activity. The presence of the chloro group can influence its reactivity and solubility, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. Additionally, 8-Chloro-1(2H)-phthalazinone may exhibit various properties such as moderate to low solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure allows for potential interactions with biological targets, which is of interest in drug design. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C8H5ClN2O
InChI:InChI=1S/C8H5ClN2O/c9-6-3-1-2-5-4-10-11-8(12)7(5)6/h1-4H,(H,11,12)
InChI key:InChIKey=LLXGUIBZJQLYJE-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=NNC2=O)=CC=C1
Synonyms:
  • 8-Chloro-1(2H)-phthalazinone
  • 1(2H)-Phthalazinone, 8-chloro-
  • 1-Phthalazinol, 8-chloro-
Found 4 products.