CAS 1015070-98-0

Ethyl 3-methyl-1H-indazole-5-carboxylate

Description:

Ethyl 3-methyl-1H-indazole-5-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a methyl group at the 3-position of the indazole ring influences its electronic properties and steric hindrance, potentially affecting its biological activity. Ethyl 3-methyl-1H-indazole-5-carboxylate is often utilized in synthetic organic chemistry for the development of pharmaceuticals and agrochemicals due to its versatile reactivity. It may exhibit various biological activities, making it of interest in medicinal chemistry. The compound is typically handled with standard laboratory safety precautions, as with many organic compounds, and its properties can be further explored through techniques such as NMR spectroscopy and mass spectrometry for structural elucidation. Overall, this compound represents a valuable building block in the synthesis of more complex molecules.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1S/C11H12N2O2/c1-3-15-11(14)8-4-5-10-9(6-8)7(2)12-13-10/h4-6H,3H2,1-2H3,(H,12,13)

InChI key: InChIKey=UHEMJGLZICDOMB-UHFFFAOYSA-N

SMILES: CC=1C=2C(=CC=C(C(OCC)=O)C2)NN1

Synonyms:

• Ethyl 3-methyl-1H-indazole-5-carboxylate
• 3-Methyl-1H-indazole-5-carboxylic acid ethyl ester
• 1H-Indazole-5-carboxylic acid, 3-methyl-, ethyl ester