CAS 1015082-81-1

Borate(1-), trifluoro[4-(2-hydroxyethyl)phenyl]-, potassium (1:1), (T-4)-

Description:

Borate(1-), trifluoro[4-(2-hydroxyethyl)phenyl]-, potassium (1:1), commonly referred to by its CAS number 1015082-81-1, is a chemical compound that features a borate anion with a trifluoromethyl group and a hydroxyethyl-substituted phenyl moiety. This compound is characterized by its ionic nature, where the potassium ion balances the negative charge of the borate. The presence of the trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential applications in various fields such as materials science and pharmaceuticals. The hydroxyethyl group enhances solubility in polar solvents and may influence the compound's reactivity and interaction with biological systems. Additionally, the compound may exhibit interesting optical properties due to the aromatic ring structure. Overall, this borate derivative is of interest for its potential applications in organic synthesis and as a reagent in various chemical reactions, although specific applications would depend on further research and characterization.

Formula: C₈H₉BF₃O·K

InChI: InChI=1S/C8H9BF3O.K/c10-9(11,12)8-3-1-7(2-4-8)5-6-13;/h1-4,13H,5-6H2;/q-1;+1

InChI key: InChIKey=JAMORWGBQKAJSF-UHFFFAOYSA-N

SMILES: [B+3]([F-])([F-])([F-])[C-]=1C=CC(CCO)=CC1.[K+]

Synonyms:

• Borate(1-), trifluoro[4-(2-hydroxyethyl)phenyl]-, potassium (1:1), (T-4)-