CAS 101513-70-6

3,5-Dichloro-2,4-difluorobenzoyl fluoride

Description:

3,5-Dichloro-2,4-difluorobenzoyl fluoride is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with multiple halogen atoms. Specifically, it features two chlorine atoms at the 3 and 5 positions and two fluorine atoms at the 2 and 4 positions of the benzene ring, along with a benzoyl fluoride functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its reactivity due to the presence of the benzoyl fluoride moiety, which can participate in various chemical reactions, including nucleophilic substitutions. The presence of multiple halogens contributes to its potential applications in agrochemicals and pharmaceuticals, as well as its role as an intermediate in organic synthesis. Additionally, due to its halogen content, it may exhibit unique physical properties such as increased stability and lipophilicity, making it of interest in various chemical research and industrial applications. Proper handling and safety precautions are essential due to its potential toxicity and environmental impact.

Formula: C₇HCl₂F₃O

InChI: InChI=1S/C7HCl2F3O/c8-3-1-2(7(12)13)5(10)4(9)6(3)11/h1H

InChI key: InChIKey=VWNMVYACOKCDLR-UHFFFAOYSA-N

SMILES: C(F)(=O)C1=C(F)C(Cl)=C(F)C(Cl)=C1

Synonyms:

• 2,4-Difluoro-3,5-Dichlorobenzoyl Fluoride
• Benzoyl fluoride, 3,5-dichloro-2,4-difluoro-
• 3,5-Dichloro-2,4-difluorobenzoyl fluoride