CymitQuimica logo

CAS 101513-72-8

:

3,5-Dichloro-2,4-difluorobenzoyl chloride

Description:
3,5-Dichloro-2,4-difluorobenzoyl chloride is an organic compound characterized by its aromatic structure, featuring a benzoyl chloride moiety with multiple halogen substituents. Specifically, it contains two chlorine atoms at the 3 and 5 positions and two fluorine atoms at the 2 and 4 positions of the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, especially in the preparation of various pharmaceuticals and agrochemicals. The presence of halogens can also influence its chemical properties, such as increased lipophilicity and potential biological activity. As with many chlorinated and fluorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C7HCl3F2O
InChI:InChI=1/C7HCl3F2O/c8-3-1-2(7(10)13)5(11)4(9)6(3)12/h1H
SMILES:c1c(c(c(c(c1Cl)F)Cl)F)C(=O)Cl
Synonyms:
  • 3,5-dichloro-2,4-difluoro-Benzoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.