CymitQuimica logo

CAS 101517-09-3

:

(azaniumylcarbonimidoyl)-[(4-methoxynaphthalen-1-yl)methyl]azanium sul fate

Description:
The chemical substance known as (azaniumylcarbonimidoyl)-[(4-methoxynaphthalen-1-yl)methyl]azanium sulfate, with the CAS number 101517-09-3, is a complex organic compound that features multiple functional groups, including azanium (protonated amine) and imidoyl groups, which suggest potential basicity and reactivity. The presence of a methoxynaphthalene moiety indicates that the compound may exhibit aromatic characteristics, contributing to its stability and potential for π-π stacking interactions. The sulfate group implies that the compound is likely to be soluble in polar solvents, enhancing its utility in various chemical applications. Additionally, the structural features may allow for interesting interactions in biological systems, making it a candidate for further research in medicinal chemistry or materials science. Overall, this compound exemplifies the diversity of organic chemistry, showcasing how different functional groups can be combined to create substances with unique properties and potential applications.
Formula:C13H17N3O5S
InChI:InChI=1/C13H15N3O.H2O4S/c1-17-12-7-6-9(8-16-13(14)15)10-4-2-3-5-11(10)12;1-5(2,3)4/h2-7H,8H2,1H3,(H4,14,15,16);(H2,1,2,3,4)
Synonyms:
  • (E)-imino-N-[(4-methoxynaphthalen-1-yl)methyl]methanediaminium sulfate
  • (4-Methoxy-1-naphthalenemethyl)guanidine sulfate
  • Guanidine, 1-(4-methoxy-1-(naphthylmethyl))-, sulfate (2:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.