CAS 101517-87-7
:Dihydro-4,6-dimethyl-2-(2-methylpropyl)-4H-1,3,5-dithiazine
Description:
Dihydro-4,6-dimethyl-2-(2-methylpropyl)-4H-1,3,5-dithiazine is a heterocyclic compound characterized by its unique structure, which includes a dithiazine ring. This compound features a six-membered ring containing two nitrogen atoms and two sulfur atoms, contributing to its distinctive chemical properties. The presence of methyl and isobutyl substituents enhances its hydrophobic character, potentially influencing its solubility and reactivity. Dithiazines are known for their potential biological activity, which may include antimicrobial or antifungal properties, although specific studies on this compound may be limited. The compound's molecular structure suggests it may participate in various chemical reactions typical of heterocycles, such as nucleophilic substitutions or cycloadditions. Its CAS number, 101517-87-7, allows for precise identification in chemical databases and literature. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its stability and potential toxicity. Overall, dihydro-4,6-dimethyl-2-(2-methylpropyl)-4H-1,3,5-dithiazine represents an interesting subject for further research in organic and medicinal chemistry.
Formula:C9H19NS2
InChI:InChI=1S/C9H19NS2/c1-6(2)5-9-11-7(3)10-8(4)12-9/h6-10H,5H2,1-4H3
InChI key:InChIKey=FVPPILNIVWRBNY-UHFFFAOYSA-N
SMILES:C(C(C)C)C1SC(C)NC(C)S1
Synonyms:- 2-Isobutyl-4,6-dimethyl-1,3,5-dithiazinane
- 4,6-Dimethyl-2-(2-Methylpropyl)-1,3,5-Dithiazinane
- 4,6-Dimethyldihydro-4H-2-Isobutyl-1,3,5-dithiazine
- 4H-1,3,5-dithiazine, dihydro-4,6-dimethyl-2-(2-methylpropyl)-
- Dihydro-4,6-dimethyl-2-(2-methylpropyl)-4H-1,3,5-dithiazine
- 2-Isobutyl-4,6-dimethyldihydro-4H-1,3,5-dithiazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dihydro-4,6-dimethyl-2-(2-methylpropyl)-4H-1,3,5-dithiazine
CAS:Formula:C9H19NS2Molecular weight:205.3839
