CAS 10152-58-6
:2,2-dimethyl-3-phenyloxirane
Description:
2,2-Dimethyl-3-phenyloxirane, also known as a type of epoxide, is a cyclic ether characterized by a three-membered ring structure containing an oxygen atom and two carbon atoms, with additional substituents that influence its reactivity and properties. This compound features two methyl groups attached to the second carbon and a phenyl group at the third carbon, which contributes to its unique chemical behavior. The presence of the epoxide functional group makes it highly reactive, particularly towards nucleophiles, allowing it to participate in various chemical reactions such as ring-opening reactions. This compound is typically colorless to pale yellow and may have a sweet or aromatic odor. It is used in organic synthesis and can serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Due to its structural characteristics, it may exhibit interesting physical properties, including moderate solubility in organic solvents and potential volatility. Safety considerations should be taken into account, as epoxides can be irritants and may pose health risks upon exposure.
Formula:C10H12O
InChI:InChI=1/C10H12O/c1-10(2)9(11-10)8-6-4-3-5-7-8/h3-7,9H,1-2H3
SMILES:CC1(C)C(c2ccccc2)O1
Synonyms:- Oxirane, 2,2-dimethyl-3-phenyl-
- 2,2-Dimethyl-3-phenyloxirane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,2-Dimethyl-3-phenyloxirane
CAS:<p>2,2-Dimethyl-3-phenyloxirane is a hydroxy substituted cyclohexene. It can be synthesized by the elimination of hydroxy groups in cyclohexane. Hydroxy groups are eliminated through reaction with ethylene oxide and phosphonic acid. The compound can be used as an intermediate for the production of some pharmaceuticals, such as adrenoreceptor agonists and alicyclic drugs. 2,2-Dimethyl-3-phenyloxirane has a chemical formula of C8H14O2. It contains 8 carbon atoms, 14 hydrogen atoms, and 2 oxygen atoms. It also has a molecular weight of 136.22 g/mol and a density of 0.86 g/cm3 at 20°C and 1 atmosphere pressure.</p>Formula:C10H12OPurity:Min. 95%Molecular weight:148.2 g/mol
