CymitQuimica logo

CAS 1015242-02-0

:

Hexahydro-1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1H-1,4-diazepine

Description:
Hexahydro-1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1H-1,4-diazepine is a complex organic compound characterized by its multi-cyclic structure, which includes a diazepine ring and a pyridine moiety. The presence of a dioxaborolane group contributes to its potential reactivity and applications in organic synthesis, particularly in boron chemistry. This compound is likely to exhibit properties typical of nitrogen-containing heterocycles, such as basicity and potential for hydrogen bonding. Its molecular structure suggests it may have applications in medicinal chemistry, possibly as a pharmaceutical intermediate or a ligand in coordination chemistry. The presence of multiple functional groups indicates that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the steric bulk introduced by the tetramethyl groups may influence its solubility and reactivity. Overall, this compound represents a unique combination of structural features that could be explored for various chemical applications.
Formula:C17H28BN3O2
InChI:InChI=1S/C17H28BN3O2/c1-16(2)17(3,4)23-18(22-16)14-7-8-15(19-13-14)21-10-6-9-20(5)11-12-21/h7-8,13H,6,9-12H2,1-5H3
InChI key:InChIKey=ZNFYRODGOMBSIZ-UHFFFAOYSA-N
SMILES:CC1(C)OB(C=2C=CC(=NC2)N3CCCN(C)CC3)OC1(C)C
Synonyms:
  • Hexahydro-1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1H-1,4-diazepine
  • 1H-1,4-Diazepine, hexahydro-1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.