CymitQuimica logo

CAS 1015242-06-4

:

N-Methyl-N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine

Description:
N-Methyl-N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a boron-containing moiety. The presence of the dioxaborolane group suggests potential applications in medicinal chemistry, particularly in drug design and development, due to its ability to form stable complexes with various biological targets. The compound features a methyl and a branched alkyl group, which may influence its solubility and lipophilicity, affecting its pharmacokinetic properties. Additionally, the nitrogen atoms in the pyrimidine and amine groups contribute to its basicity and potential reactivity. This compound may exhibit specific biological activities, making it of interest in pharmaceutical research. However, detailed studies on its toxicity, stability, and interaction with biological systems would be necessary to fully understand its characteristics and potential applications.
Formula:C15H26BN3O2
InChI:InChI=1S/C15H26BN3O2/c1-11(2)10-19(7)13-17-8-12(9-18-13)16-20-14(3,4)15(5,6)21-16/h8-9,11H,10H2,1-7H3
InChI key:InChIKey=KXEXRGGBANRTIB-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=NC(N(CC(C)C)C)=NC2
Synonyms:
  • N-Methyl-N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine
  • 2-Pyrimidinamine, N-methyl-N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.