CAS 101527-45-1
:alpha-monofluorothymidine
Description:
Alpha-monofluorothymidine, with the CAS number 101527-45-1, is a nucleoside analog of thymidine, where a fluorine atom is substituted at the alpha position of the sugar moiety. This modification can influence its biological activity, particularly in the context of antiviral and anticancer research. The presence of the fluorine atom can enhance the compound's stability and alter its interaction with nucleic acid synthesis pathways. Alpha-monofluorothymidine is typically characterized by its ability to inhibit viral replication and may exhibit cytotoxic effects on certain cancer cell lines, making it a subject of interest in medicinal chemistry. Its solubility and stability in biological systems are crucial for its potential therapeutic applications. Additionally, the compound's structure allows it to mimic natural nucleosides, which can facilitate its incorporation into DNA during replication, potentially leading to chain termination or mutations. Overall, alpha-monofluorothymidine represents a valuable tool in the development of antiviral and anticancer therapies.
Formula:C10H13FN2O5
InChI:InChI=1/C10H13FN2O5/c11-2-5-3-13(10(17)12-9(5)16)8-1-6(15)7(4-14)18-8/h3,6-8,14-15H,1-2,4H2,(H,12,16,17)/t6-,7+,8+/m0/s1
Synonyms:- 5-Monofluoromethyl-2'-deoxyuridine
- F-Tdr
- alpha-Fluorothymidine
- Thymidine, alpha-fluoro-
- 2'-Deoxy-5-(Fluoromethyl)Uridine
- alpha-Monofluorothymidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
