CAS 10153-16-9
:2-(phenylcarbamothioyl)hydrazinecarboxamide
Description:
2-(Phenylcarbamothioyl)hydrazinecarboxamide, with the CAS number 10153-16-9, is a chemical compound that belongs to the class of hydrazine derivatives. It features a hydrazine core, which is characterized by the presence of a hydrazine (-NH-NH2) functional group, and is substituted with a phenylcarbamothioyl group and a carboxamide moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. Its structure suggests potential reactivity, particularly in nucleophilic substitution reactions, owing to the presence of the thiocarbonyl and amide functionalities. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. The presence of the phenyl group may also contribute to its stability and influence its interaction with biological targets. Overall, 2-(phenylcarbamothioyl)hydrazinecarboxamide is a compound of interest for further research in various chemical and biological applications.
Formula:C8H10N4OS
InChI:InChI=1/C8H10N4OS/c9-7(13)11-12-8(14)10-6-4-2-1-3-5-6/h1-5H,(H3,9,11,13)(H2,10,12,14)
SMILES:c1ccc(cc1)N=C(NNC(=N)O)S
Synonyms:- Hydrazinecarboxamide, 2-[(Phenylamino)Thioxomethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.