CAS 10154-71-9

3-(phenylsulfonyl)propionic acid

Description:

3-(Phenylsulfonyl)propionic acid, with the CAS number 10154-71-9, is an organic compound characterized by the presence of a propionic acid moiety substituted with a phenylsulfonyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid functional group. The phenylsulfonyl group enhances its reactivity and can participate in various chemical reactions, making it useful in synthetic organic chemistry. The compound exhibits acidic properties due to the carboxylic acid functional group, which can donate protons in solution. Additionally, it may have applications in pharmaceuticals and agrochemicals, particularly in the development of sulfonamide derivatives. Its structural features contribute to its potential biological activity, although specific biological properties would require further investigation. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₀O₄S

InChI: InChI=1/C9H10O4S/c10-9(11)6-7-14(12,13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)

SMILES: c1ccc(cc1)S(=O)(=O)CCC(=O)O

Synonyms:

• 3-(Phenylsulphonyl)Propionic Acid
• 3-(Phenylsulfonyl)Propanoic Acid

Propanoic acid, 3-(phenylsulfonyl)-

CAS: 10154-71-9

Formula: C₉H₁₀O₄S

Purity: 96%

Color and Shape: Solid

Molecular weight: 214.2383

Ref: IN-DA0004R9

Phenylsulfonylpropionic acid

CAS: 10154-71-9

Phenylsulfonylpropionic acid

Purity: 98%

Molecular weight: 214.24g/mol

Ref: 54-OR73300

3-(Phenylsulfonyl)propanoic acid

CAS: 10154-71-9

Formula: C₉H₁₀O₄S

Purity: 96%

Color and Shape: Solid

Molecular weight: 214.24

Ref: 10-F307195