CAS 10154-76-4
:3-(TOLUENE-4-SULFONYL)-PROPIONIC ACID
Description:
3-(Toluene-4-sulfonyl)-propionic acid, with the CAS number 10154-76-4, is an organic compound characterized by the presence of a propionic acid moiety attached to a toluene-4-sulfonyl group. This compound typically exhibits properties associated with both sulfonic acids and carboxylic acids, including solubility in polar solvents and the ability to participate in acid-base reactions. The sulfonyl group enhances the compound's reactivity, making it useful in various chemical syntheses and applications, particularly in the pharmaceutical and agrochemical industries. The presence of the toluene moiety contributes to its hydrophobic characteristics, which can influence its interaction with biological systems. Additionally, this compound may exhibit biological activity, although specific pharmacological properties would depend on its structural context and the presence of other functional groups. Overall, 3-(toluene-4-sulfonyl)-propionic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C10H11O4S
InChI:InChI=1/C10H12O4S/c1-8-2-4-9(5-3-8)15(13,14)7-6-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)/p-1
SMILES:Cc1ccc(cc1)S(=O)(=O)CCC(=O)[O-]
Synonyms:- 3-[(4-Methylphenyl)sulfonyl]propanoic acid
- Propanoic acid, 3-[(4-methylphenyl)sulfonyl]-
- 3-[(4-Methylphenyl)Sulfonyl]Propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(4-Methylbenzenesulfonyl)propanoic acid
CAS:<p>3-(4-Methylbenzenesulfonyl)propanoic acid (MBPSA) is a tosylated analog of the electrophile propanoic acid. It reacts with nucleophiles and heteroatoms to form an ionic product with a negative charge on the carbon atom adjacent to the sulfonate group. The carbonyl group in MBPSA is susceptible to nucleophilic attack by lithium, forming lithium enolate. This enolate can react with other electrophiles, such as anion or carbonyls, to form a new molecule containing the original electrophile and a sulfonate group.</p>Formula:C10H12O4SPurity:Min. 95%Molecular weight:228.27 g/mol
