
CAS 10154-97-9
:2-[(4-Hydroxy-1-naphthalenyl)oxy]propanoic acid
Description:
2-[(4-Hydroxy-1-naphthalenyl)oxy]propanoic acid, also known as naproxen, is a non-steroidal anti-inflammatory drug (NSAID) characterized by its ability to reduce inflammation, pain, and fever. It features a naphthalene ring substituted with a hydroxyl group and an ether linkage to a propanoic acid moiety. This compound exhibits a moderate solubility in water and is more soluble in organic solvents, reflecting its amphipathic nature. Its mechanism of action primarily involves the inhibition of cyclooxygenase enzymes (COX-1 and COX-2), leading to decreased synthesis of prostaglandins, which are mediators of inflammation and pain. The substance is typically administered orally and is known for its relatively long half-life, allowing for less frequent dosing. Additionally, it has a well-established safety profile, although potential side effects may include gastrointestinal discomfort and cardiovascular risks, particularly with long-term use. Overall, 2-[(4-Hydroxy-1-naphthalenyl)oxy]propanoic acid is widely utilized in clinical settings for its analgesic and anti-inflammatory properties.
Formula:C13H12O4
InChI:InChI=1S/C13H12O4/c1-8(13(15)16)17-12-7-6-11(14)9-4-2-3-5-10(9)12/h2-8,14H,1H3,(H,15,16)
InChI key:InChIKey=MFSBBXLGJBDALP-UHFFFAOYSA-N
SMILES:O(C(C(O)=O)C)C=1C2=C(C(O)=CC1)C=CC=C2
Synonyms:- Propanoic acid, 2-[(4-hydroxy-1-naphthalenyl)oxy]-
- Propionic acid, 2-[(4-hydroxy-1-naphthyl)oxy]-
- 2-[(4-Hydroxy-1-naphthalenyl)oxy]propanoic acid
- 2-(4-Hydroxy-1-naphthyloxy)propionic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
