CAS 10155-48-3

7-Bromo-3-hydroxy-N-[3-(4-morpholinyl)propyl]-2-naphthalenecarboxamide

Description:

7-Bromo-3-hydroxy-N-[3-(4-morpholinyl)propyl]-2-naphthalenecarboxamide, with CAS number 10155-48-3, is a chemical compound characterized by its complex structure, which includes a naphthalene ring substituted with a bromine atom and a hydroxyl group, as well as an amide functional group. The presence of the morpholine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit biological activity due to its ability to interact with various biological targets, potentially influencing pathways related to neurotransmission or other physiological processes. Its solubility and stability can be influenced by the functional groups present, making it important for formulation in drug development. Additionally, the bromine substituent can enhance lipophilicity, which may affect the compound's pharmacokinetics. Overall, the unique structural features of this compound contribute to its potential utility in research and therapeutic applications, although specific biological activities and mechanisms would require further investigation.

Formula: C₁₈H₂₁BrN₂O₃

InChI: InChI=1S/C18H21BrN2O3/c19-15-3-2-13-12-17(22)16(11-14(13)10-15)18(23)20-4-1-5-21-6-8-24-9-7-21/h2-3,10-12,22H,1,4-9H2,(H,20,23)

InChI key: InChIKey=PVZXJTNWDZNFJH-UHFFFAOYSA-N

SMILES: C(NCCCN1CCOCC1)(=O)C2=CC3=C(C=C2O)C=CC(Br)=C3

Synonyms:

• 2-Naphthamide, 7-bromo-3-hydroxy-N-(3-morpholinopropyl)-
• 7-Bromo-3-hydroxy-N-[3-(4-morpholinyl)propyl]-2-naphthalenecarboxamide
• 2-Naphthalenecarboxamide, 7-bromo-3-hydroxy-N-[3-(4-morpholinyl)propyl]-

2-Naphthalenecarboxamide, 7-bromo-3-hydroxy-N-[3-(4-morpholinyl)propyl]-

CAS: 10155-48-3

Formula: C₁₈H₂₁BrN₂O₃

Molecular weight: 393.2749

Ref: IN-DA0004S1