CAS 101555-60-6
:BOC-D-BETA-HOMOPROLINE
Description:
BOC-D-Beta-Homoproline, with the CAS number 101555-60-6, is a chemical compound that belongs to the class of amino acids, specifically a derivative of proline. It features a tert-butyloxycarbonyl (BOC) protecting group, which is commonly used in peptide synthesis to protect the amino group from undesired reactions. The "D" designation indicates that it is the D-enantiomer, which is important in biological contexts as the stereochemistry can influence the compound's interactions and functions. Beta-homoproline is characterized by its five-membered ring structure, which contributes to its unique conformational properties compared to standard proline. This compound is often utilized in the synthesis of peptides and other bioactive molecules, making it valuable in pharmaceutical and biochemical research. Its solubility and stability under various conditions are also notable, allowing for versatility in laboratory applications. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C6H12ClNO2
InChI:InChI=1/C6H11NO2.ClH/c8-6(9)4-5-2-1-3-7-5;/h5,7H,1-4H2,(H,8,9);1H/t5-;/m1./s1
SMILES:C1C[C@H](CC(=O)O)NC1.Cl
Synonyms:- Rarechem Ak Pt F109
- (R)-2-Carboxymethyl-Pyrrolidine-1-Carboxylic Acid Tert-Butyl Ester
- Boc-D-b-HoPro-OH
- 2-[(2R)-pyrrolidin-2-yl]acetic acid hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Pyrrolidineacetic acid, 1-[(1,1-dimethylethoxy)carbonyl]-, (2R)-
CAS:Formula:C11H19NO4Purity:98%Color and Shape:SolidMolecular weight:229.2729(R)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-2-yl)acetic acid
CAS:(R)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-2-yl)acetic acidPurity:95%Molecular weight:229.27g/mol(R)-2-Carboxymethyl-pyrrolidine-1-carboxylic acidtert-butyl ester
CAS:Formula:C11H19NO4Purity:98%Color and Shape:SolidMolecular weight:229.276N-Boc-D-b-homoproline
CAS:Please enquire for more information about N-Boc-D-b-homoproline including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H19NO4Purity:Min. 95%Molecular weight:229.27 g/mol



