
CAS 10156-37-3
:2-Mercapto-N-1-naphthalenylacetamide
Description:
2-Mercapto-N-1-naphthalenylacetamide, with the CAS number 10156-37-3, is an organic compound characterized by the presence of a mercapto group (-SH) and an acetamide functional group attached to a naphthalene ring. This compound typically exhibits properties associated with thiols, such as a strong odor and the ability to form disulfide bonds under oxidative conditions. It is soluble in organic solvents and may have limited solubility in water due to its hydrophobic naphthalene structure. The presence of the naphthalene moiety contributes to its aromatic characteristics, which can influence its reactivity and stability. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to act as a ligand in coordination chemistry. Additionally, its thiol group can participate in redox reactions, making it a candidate for applications in antioxidant formulations or as a reducing agent in synthetic processes.
Formula:C12H11NOS
InChI:InChI=1S/C12H11NOS/c14-12(8-15)13-11-7-3-5-9-4-1-2-6-10(9)11/h1-7,15H,8H2,(H,13,14)
InChI key:InChIKey=LAZZFNUBDVWSLI-UHFFFAOYSA-N
SMILES:N(C(CS)=O)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- 2-Mercapto-N-1-naphthalenylacetamide
- Acetamide, 2-mercapto-N-1-naphthyl-
- Acetamide, 2-mercapto-N-1-naphthalenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
