CAS 1015610-31-7

2H-Azeto[1,2-A]oxazolo[5,4-E]pyridine

Description:

2H-Azeto[1,2-A]oxazolo[5,4-E]pyridine, with the CAS number 1015610-31-7, is a heterocyclic compound that features a fused ring system incorporating both azetidine and oxazole moieties. This compound is characterized by its unique structural arrangement, which contributes to its potential biological activity and chemical reactivity. Typically, compounds of this nature may exhibit properties such as fluorescence, making them useful in various applications, including medicinal chemistry and material science. The presence of nitrogen and oxygen atoms within the ring structure can influence the compound's polarity, solubility, and interaction with biological targets. Additionally, the specific arrangement of substituents on the rings can lead to diverse pharmacological profiles, making such compounds of interest in drug discovery. As with many heterocycles, the stability and reactivity of 2H-Azeto[1,2-A]oxazolo[5,4-E]pyridine can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₇H₄ClIN₂

InChI: InChI=1S/C7H4ClIN2/c8-6-4-1-2-10-7(4)11-3-5(6)9/h1-3H,(H,10,11)

SMILES: c1cnc2c1c(c(c[nH]2)I)Cl

Synonyms:

• 4-Chloro-5-iodo-1H-pyrrolo[2,3-b]pyridine

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-iodo-

CAS: 1015610-31-7

Formula: C₇H₄ClIN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 278.4775

Ref: IN-DA0004SW

4-Chloro-5-iodo-1H-pyrrolo[2,3-b]pyridine

CAS: 1015610-31-7

4-Chloro-5-iodo-1H-pyrrolo[2,3-b]pyridine

Purity: 97%

Molecular weight: 278.48g/mol

Ref: 54-OR75478

4-Chloro-5-iodo-1H-pyrrolo[2,3-b]pyridine

CAS: 1015610-31-7

Formula: C₇H₄ClIN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 278.48

Ref: 10-F092625